4-butoxy-N-[(5-methylfuran-2-yl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
4-butoxy-N-[(5-methylfuran-2-yl)methyl]-N-(pyridin-2-yl)benzamide
4-butoxy-N-[(5-methylfuran-2-yl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D341-1336 |
| Compound Name: | 4-butoxy-N-[(5-methylfuran-2-yl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 364.44 |
| Molecular Formula: | C22 H24 N2 O3 |
| Smiles: | CCCCOc1ccc(cc1)C(N(Cc1ccc(C)o1)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1286 |
| logD: | 5.1286 |
| logSw: | -4.8279 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.781 |
| InChI Key: | HLOXWVXUXUDYIY-UHFFFAOYSA-N |