4-bromo-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
4-bromo-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
4-bromo-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D341-1490 |
| Compound Name: | 4-bromo-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 397.27 |
| Molecular Formula: | C20 H17 Br N2 O2 |
| Smiles: | COc1ccc(CN(C(c2ccc(cc2)[Br])=O)c2ccccn2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9076 |
| logD: | 4.9075 |
| logSw: | -4.6038 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.645 |
| InChI Key: | SSIUNNMMLOSKNX-UHFFFAOYSA-N |