2-ethoxy-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
Chemical Structure Depiction of
2-ethoxy-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
2-ethoxy-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide
Compound characteristics
| Compound ID: | D341-1535 |
| Compound Name: | 2-ethoxy-N-[(4-methoxyphenyl)methyl]-N-(pyridin-2-yl)benzamide |
| Molecular Weight: | 362.43 |
| Molecular Formula: | C22 H22 N2 O3 |
| Smiles: | CCOc1ccccc1C(N(Cc1ccc(cc1)OC)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4564 |
| logD: | 4.4564 |
| logSw: | -4.4491 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.855 |
| InChI Key: | JNCADXBQDFFOEG-UHFFFAOYSA-N |