N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
Chemical Structure Depiction of
N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3-dimethylphenoxy)-N-(pyridin-2-yl)acetamide
Compound characteristics
| Compound ID: | D341-1614 |
| Compound Name: | N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3-dimethylphenoxy)-N-(pyridin-2-yl)acetamide |
| Molecular Weight: | 406.48 |
| Molecular Formula: | C24 H26 N2 O4 |
| Smiles: | Cc1cccc(c1C)OCC(N(Cc1ccc(c(c1)OC)OC)c1ccccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4212 |
| logD: | 4.4212 |
| logSw: | -4.4911 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.42 |
| InChI Key: | BHNFVXQJJULNHG-UHFFFAOYSA-N |