N-[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzene-1-sulfonamide
N-[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | D344-2552 |
| Compound Name: | N-[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 412.89 |
| Molecular Formula: | C21 H17 Cl N2 O3 S |
| Smiles: | Cc1ccc(cc1)S(Nc1cc(ccc1C)c1nc2cc(ccc2o1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6114 |
| logD: | 5.6051 |
| logSw: | -6.0966 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57 |
| InChI Key: | WUXUFQCLIRDWDR-UHFFFAOYSA-N |