N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzamide
Chemical Structure Depiction of
N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzamide
N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzamide
Compound characteristics
| Compound ID: | D344-2777 |
| Compound Name: | N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-4-methylbenzamide |
| Molecular Weight: | 376.84 |
| Molecular Formula: | C22 H17 Cl N2 O2 |
| Smiles: | Cc1ccc(cc1)C(Nc1cccc(c1C)c1nc2cc(ccc2o1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.7122 |
| logD: | 5.7121 |
| logSw: | -5.9074 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.442 |
| InChI Key: | OQWLCJGRXBVSEM-UHFFFAOYSA-N |