N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide
N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | D344-7177 |
| Compound Name: | N-[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide |
| Molecular Weight: | 338.36 |
| Molecular Formula: | C18 H11 F N2 O2 S |
| Smiles: | c1ccc(c(c1)c1nc2cc(ccc2o1)NC(c1cccs1)=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.374 |
| logD: | 4.3738 |
| logSw: | -4.5373 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.158 |
| InChI Key: | ZHALIPXZTNAKHY-UHFFFAOYSA-N |