N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-phenylpropanamide
Chemical Structure Depiction of
N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-phenylpropanamide
N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-phenylpropanamide
Compound characteristics
| Compound ID: | D344-7376 |
| Compound Name: | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-phenylpropanamide |
| Molecular Weight: | 360.39 |
| Molecular Formula: | C22 H17 F N2 O2 |
| Smiles: | C(Cc1ccccc1)C(Nc1ccc2c(c1)nc(c1ccc(cc1)F)o2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9516 |
| logD: | 4.9515 |
| logSw: | -5.0483 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.926 |
| InChI Key: | OLQHXBQCUBYMBI-UHFFFAOYSA-N |