2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-cyclohexyl-N-methylacetamide
Chemical Structure Depiction of
2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-cyclohexyl-N-methylacetamide
2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-cyclohexyl-N-methylacetamide
Compound characteristics
| Compound ID: | D344-8103 |
| Compound Name: | 2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-cyclohexyl-N-methylacetamide |
| Molecular Weight: | 365.88 |
| Molecular Formula: | C17 H20 Cl N3 O2 S |
| Smiles: | CN(C1CCCCC1)C(CSc1nnc(c2ccc(cc2)[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7792 |
| logD: | 3.7792 |
| logSw: | -4.2799 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.01 |
| InChI Key: | BMIAHXVYINXNRW-UHFFFAOYSA-N |