2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide
Chemical Structure Depiction of
2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide
2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide
Compound characteristics
| Compound ID: | D344-8138 |
| Compound Name: | 2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| Molecular Weight: | 381.86 |
| Molecular Formula: | C14 H12 Cl N5 O2 S2 |
| Smiles: | CCc1nnc(NC(CSc2nnc(c3ccc(cc3)[Cl])o2)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.266 |
| logD: | 3.2183 |
| logSw: | -3.7317 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.254 |
| InChI Key: | ZCKOQHGASLTQKL-UHFFFAOYSA-N |