2-(4-chlorophenyl)-5-{[2-(2-methoxyphenoxy)ethyl]sulfanyl}-1,3,4-oxadiazole
Chemical Structure Depiction of
2-(4-chlorophenyl)-5-{[2-(2-methoxyphenoxy)ethyl]sulfanyl}-1,3,4-oxadiazole
2-(4-chlorophenyl)-5-{[2-(2-methoxyphenoxy)ethyl]sulfanyl}-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | D344-8149 |
| Compound Name: | 2-(4-chlorophenyl)-5-{[2-(2-methoxyphenoxy)ethyl]sulfanyl}-1,3,4-oxadiazole |
| Molecular Weight: | 362.83 |
| Molecular Formula: | C17 H15 Cl N2 O3 S |
| Smiles: | COc1ccccc1OCCSc1nnc(c2ccc(cc2)[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 3.8921 |
| logD: | 3.8921 |
| logSw: | -4.4879 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.199 |
| InChI Key: | YVSWMAFRKOOCHI-UHFFFAOYSA-N |