7-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Chemical Structure Depiction of
7-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Compound characteristics
| Compound ID: | D344-8326 |
| Compound Name: | 7-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| Molecular Weight: | 390.87 |
| Molecular Formula: | C16 H11 Cl N4 O2 S2 |
| Smiles: | CC1=CSC2=NC(CSc3nnc(c4ccccc4[Cl])o3)=CC(N12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7505 |
| logD: | 2.7505 |
| logSw: | -3.6341 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.684 |
| InChI Key: | PRHUTNOKDFDZEJ-UHFFFAOYSA-N |