N-methyl-2-{[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-phenylacetamide
Chemical Structure Depiction of
N-methyl-2-{[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-phenylacetamide
N-methyl-2-{[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-phenylacetamide
Compound characteristics
| Compound ID: | D344-8498 |
| Compound Name: | N-methyl-2-{[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}-N-phenylacetamide |
| Molecular Weight: | 339.41 |
| Molecular Formula: | C18 H17 N3 O2 S |
| Smiles: | Cc1cccc(c1)c1nnc(o1)SCC(N(C)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8124 |
| logD: | 2.8124 |
| logSw: | -3.1378 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.177 |
| InChI Key: | PHCSGFMPCOVWAJ-UHFFFAOYSA-N |