(4-methylphenyl){4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(4-methylphenyl){4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone
(4-methylphenyl){4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | D345-0002 |
| Compound Name: | (4-methylphenyl){4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}methanone |
| Molecular Weight: | 309.41 |
| Molecular Formula: | C19 H23 N3 O |
| Smiles: | Cc1ccc(cc1)C(N1CCN(CCc2ccccn2)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0836 |
| logD: | 2.0632 |
| logSw: | -2.2274 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.9486 |
| InChI Key: | IWIVNDLVVFNBAY-UHFFFAOYSA-N |