2-(2-methylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
2-(2-methylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one--hydrogen chloride (1/1)
2-(2-methylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | D345-0021 |
| Compound Name: | 2-(2-methylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one--hydrogen chloride (1/1) |
| Molecular Weight: | 375.9 |
| Molecular Formula: | C20 H25 N3 O2 |
| Salt: | HCl |
| Smiles: | Cc1ccccc1OCC(N1CCN(CCc2ccccn2)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.916 |
| logD: | 1.8802 |
| logSw: | -1.8608 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.007 |
| InChI Key: | WVHGPZCIFFIXSJ-UHFFFAOYSA-N |