2-(4-ethylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one
Chemical Structure Depiction of
2-(4-ethylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one
2-(4-ethylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | D345-0079 |
| Compound Name: | 2-(4-ethylphenoxy)-1-{4-[2-(pyridin-2-yl)ethyl]piperazin-1-yl}ethan-1-one |
| Molecular Weight: | 353.46 |
| Molecular Formula: | C21 H27 N3 O2 |
| Smiles: | CCc1ccc(cc1)OCC(N1CCN(CCc2ccccn2)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.372 |
| logD: | 2.3361 |
| logSw: | -2.2072 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.92 |
| InChI Key: | UDIKDKCEVWWHEP-UHFFFAOYSA-N |