ethyl {2-[(2-phenoxyethyl)sulfanyl]-1H-benzimidazol-1-yl}acetate
Chemical Structure Depiction of
ethyl {2-[(2-phenoxyethyl)sulfanyl]-1H-benzimidazol-1-yl}acetate
ethyl {2-[(2-phenoxyethyl)sulfanyl]-1H-benzimidazol-1-yl}acetate
Compound characteristics
| Compound ID: | D347-0032 |
| Compound Name: | ethyl {2-[(2-phenoxyethyl)sulfanyl]-1H-benzimidazol-1-yl}acetate |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C19 H20 N2 O3 S |
| Smiles: | CCOC(Cn1c2ccccc2nc1SCCOc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2508 |
| logD: | 4.2467 |
| logSw: | -4.0691 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.325 |
| InChI Key: | GHDVODLLQNDIOO-UHFFFAOYSA-N |