1-(2,6-dimethylphenyl)-4-[1-(2-methylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(2,6-dimethylphenyl)-4-[1-(2-methylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
1-(2,6-dimethylphenyl)-4-[1-(2-methylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | D347-2003 |
| Compound Name: | 1-(2,6-dimethylphenyl)-4-[1-(2-methylprop-2-en-1-yl)-1H-benzimidazol-2-yl]pyrrolidin-2-one |
| Molecular Weight: | 359.47 |
| Molecular Formula: | C23 H25 N3 O |
| Smiles: | CC(=C)Cn1c2ccccc2nc1C1CC(N(C1)c1c(C)cccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.044 |
| logD: | 5.044 |
| logSw: | -4.6473 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.3151 |
| InChI Key: | FQKUQYMXBYRVSI-GOSISDBHSA-N |