1-{1-[(2-chloro-6-fluorophenyl)methyl]-1H-benzimidazol-2-yl}butan-1-ol
Chemical Structure Depiction of
1-{1-[(2-chloro-6-fluorophenyl)methyl]-1H-benzimidazol-2-yl}butan-1-ol
1-{1-[(2-chloro-6-fluorophenyl)methyl]-1H-benzimidazol-2-yl}butan-1-ol
Compound characteristics
| Compound ID: | D347-4156 |
| Compound Name: | 1-{1-[(2-chloro-6-fluorophenyl)methyl]-1H-benzimidazol-2-yl}butan-1-ol |
| Molecular Weight: | 332.8 |
| Molecular Formula: | C18 H18 Cl F N2 O |
| Smiles: | CCCC(c1nc2ccccc2n1Cc1c(cccc1[Cl])F)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8195 |
| logD: | 4.8172 |
| logSw: | -4.6901 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.3192 |
| InChI Key: | DNWCNFZWDYKZFR-KRWDZBQOSA-N |