N,N-dimethyl-2-nitro-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline
Chemical Structure Depiction of
N,N-dimethyl-2-nitro-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline
N,N-dimethyl-2-nitro-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline
Compound characteristics
| Compound ID: | D349-2837 |
| Compound Name: | N,N-dimethyl-2-nitro-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| Molecular Weight: | 400.39 |
| Molecular Formula: | C19 H20 N4 O6 |
| Smiles: | CN(C)c1ccc(cc1[N+]([O-])=O)c1nc(c2cc(c(c(c2)OC)OC)OC)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.5989 |
| logD: | 3.5989 |
| logSw: | -4.0584 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 90.206 |
| InChI Key: | OVGDAEHQLCSRDI-UHFFFAOYSA-N |