1-(3-chlorophenyl)-N-(2,6-dimethylphenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
Chemical Structure Depiction of
1-(3-chlorophenyl)-N-(2,6-dimethylphenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
1-(3-chlorophenyl)-N-(2,6-dimethylphenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
Compound characteristics
| Compound ID: | D351-2774 |
| Compound Name: | 1-(3-chlorophenyl)-N-(2,6-dimethylphenyl)-5-(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide |
| Molecular Weight: | 432.91 |
| Molecular Formula: | C24 H21 Cl N4 O2 |
| Smiles: | Cc1cccc(C)c1NC(c1nc(c2ccc(cc2)OC)n(c2cccc(c2)[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5071 |
| logD: | 5.5071 |
| logSw: | -6.0095 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.129 |
| InChI Key: | PPYUGLLDMOSUQJ-UHFFFAOYSA-N |