1-(2-chlorophenyl)-N,5-bis(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
Chemical Structure Depiction of
1-(2-chlorophenyl)-N,5-bis(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
1-(2-chlorophenyl)-N,5-bis(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide
Compound characteristics
| Compound ID: | D351-2850 |
| Compound Name: | 1-(2-chlorophenyl)-N,5-bis(4-methoxyphenyl)-1H-1,2,4-triazole-3-carboxamide |
| Molecular Weight: | 434.88 |
| Molecular Formula: | C23 H19 Cl N4 O3 |
| Smiles: | COc1ccc(cc1)c1nc(C(Nc2ccc(cc2)OC)=O)nn1c1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.2242 |
| logD: | 5.2242 |
| logSw: | -5.7905 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.767 |
| InChI Key: | YCGLXSUZNXIGSB-UHFFFAOYSA-N |