N-(2,5-difluorophenyl)-2-{[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-2-{[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide
N-(2,5-difluorophenyl)-2-{[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | D353-0176 |
| Compound Name: | N-(2,5-difluorophenyl)-2-{[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 407.39 |
| Molecular Formula: | C18 H15 F2 N3 O4 S |
| Smiles: | COc1ccc(cc1OC)c1nnc(o1)SCC(Nc1cc(ccc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7912 |
| logD: | 2.7812 |
| logSw: | -3.3974 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.776 |
| InChI Key: | XYVMKCNZQZIEQR-UHFFFAOYSA-N |