5-(3-fluoro-4-methylphenyl)-N-(3-{[(furan-2-yl)methyl]carbamoyl}-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(3-fluoro-4-methylphenyl)-N-(3-{[(furan-2-yl)methyl]carbamoyl}-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2-oxazole-3-carboxamide
5-(3-fluoro-4-methylphenyl)-N-(3-{[(furan-2-yl)methyl]carbamoyl}-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | D354-0114 |
| Compound Name: | 5-(3-fluoro-4-methylphenyl)-N-(3-{[(furan-2-yl)methyl]carbamoyl}-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 479.53 |
| Molecular Formula: | C25 H22 F N3 O4 S |
| Smiles: | [H]N(C(c1cc(c2ccc(C)c(c2)F)on1)=O)c1c(C(NCc2ccco2)=O)c2CCCCc2s1 |
| Stereo: | ACHIRAL |
| logP: | 5.7169 |
| logD: | 5.0914 |
| logSw: | -5.3934 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.742 |
| InChI Key: | YGQHSVJCOJXWPV-UHFFFAOYSA-N |