N-(2-ethoxyphenyl)-1-(phenylmethanesulfonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-1-(phenylmethanesulfonyl)piperidine-4-carboxamide
N-(2-ethoxyphenyl)-1-(phenylmethanesulfonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-0280 |
| Compound Name: | N-(2-ethoxyphenyl)-1-(phenylmethanesulfonyl)piperidine-4-carboxamide |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C21 H26 N2 O4 S |
| Smiles: | CCOc1ccccc1NC(C1CCN(CC1)S(Cc1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8189 |
| logD: | 2.8186 |
| logSw: | -3.3134 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.447 |
| InChI Key: | XWFZEOCXCWWCNV-UHFFFAOYSA-N |