(4-benzylpiperidin-1-yl){1-[(2-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
Chemical Structure Depiction of
(4-benzylpiperidin-1-yl){1-[(2-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
(4-benzylpiperidin-1-yl){1-[(2-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
Compound characteristics
| Compound ID: | D356-0578 |
| Compound Name: | (4-benzylpiperidin-1-yl){1-[(2-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone |
| Molecular Weight: | 454.63 |
| Molecular Formula: | C26 H34 N2 O3 S |
| Smiles: | Cc1ccccc1CS(N1CCC(CC1)C(N1CCC(CC1)Cc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9181 |
| logD: | 4.9181 |
| logSw: | -4.6577 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.22 |
| InChI Key: | IPHLCFZVTVRGNR-UHFFFAOYSA-N |