N-(3-chloro-4-fluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
N-(3-chloro-4-fluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-0594 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide |
| Molecular Weight: | 424.92 |
| Molecular Formula: | C20 H22 Cl F N2 O3 S |
| Smiles: | Cc1ccccc1CS(N1CCC(CC1)C(Nc1ccc(c(c1)[Cl])F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0755 |
| logD: | 4.0341 |
| logSw: | -4.3699 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.935 |
| InChI Key: | GXQXWZFBGIOGSR-UHFFFAOYSA-N |