1-[(2-methylphenyl)methanesulfonyl]-N-[2-(phenylsulfanyl)phenyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-[(2-methylphenyl)methanesulfonyl]-N-[2-(phenylsulfanyl)phenyl]piperidine-4-carboxamide
1-[(2-methylphenyl)methanesulfonyl]-N-[2-(phenylsulfanyl)phenyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-0638 |
| Compound Name: | 1-[(2-methylphenyl)methanesulfonyl]-N-[2-(phenylsulfanyl)phenyl]piperidine-4-carboxamide |
| Molecular Weight: | 480.65 |
| Molecular Formula: | C26 H28 N2 O3 S2 |
| Smiles: | Cc1ccccc1CS(N1CCC(CC1)C(Nc1ccccc1Sc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1823 |
| logD: | 5.1823 |
| logSw: | -4.959 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.965 |
| InChI Key: | YXIHELXNTIFXFI-UHFFFAOYSA-N |