N-(3,4-difluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3,4-difluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
N-(3,4-difluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-0642 |
| Compound Name: | N-(3,4-difluorophenyl)-1-[(2-methylphenyl)methanesulfonyl]piperidine-4-carboxamide |
| Molecular Weight: | 408.47 |
| Molecular Formula: | C20 H22 F2 N2 O3 S |
| Smiles: | Cc1ccccc1CS(N1CCC(CC1)C(Nc1ccc(c(c1)F)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.702 |
| logD: | 3.6605 |
| logSw: | -3.8306 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.935 |
| InChI Key: | FAUHYYDIPMNAJG-UHFFFAOYSA-N |