[4-(4-fluorophenyl)piperazin-1-yl]{1-[(3-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
Chemical Structure Depiction of
[4-(4-fluorophenyl)piperazin-1-yl]{1-[(3-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
[4-(4-fluorophenyl)piperazin-1-yl]{1-[(3-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone
Compound characteristics
| Compound ID: | D356-0800 |
| Compound Name: | [4-(4-fluorophenyl)piperazin-1-yl]{1-[(3-methylphenyl)methanesulfonyl]piperidin-4-yl}methanone |
| Molecular Weight: | 459.58 |
| Molecular Formula: | C24 H30 F N3 O3 S |
| Smiles: | Cc1cccc(CS(N2CCC(CC2)C(N2CCN(CC2)c2ccc(cc2)F)=O)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.6577 |
| logD: | 3.6577 |
| logSw: | -3.7809 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.752 |
| InChI Key: | QJAGSSXTKAHVBV-UHFFFAOYSA-N |