N-{3-[(methanesulfonyl)(methyl)amino]phenyl}-1-[(3-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-{3-[(methanesulfonyl)(methyl)amino]phenyl}-1-[(3-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
N-{3-[(methanesulfonyl)(methyl)amino]phenyl}-1-[(3-methylphenyl)methanesulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-0829 |
| Compound Name: | N-{3-[(methanesulfonyl)(methyl)amino]phenyl}-1-[(3-methylphenyl)methanesulfonyl]piperidine-4-carboxamide |
| Molecular Weight: | 479.62 |
| Molecular Formula: | C22 H29 N3 O5 S2 |
| Smiles: | Cc1cccc(CS(N2CCC(CC2)C(Nc2cccc(c2)N(C)S(C)(=O)=O)=O)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 2.7581 |
| logD: | 2.758 |
| logSw: | -3.1354 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.52 |
| InChI Key: | HYCQXKLPMDKDRR-UHFFFAOYSA-N |