1-[(4-fluorophenyl)methanesulfonyl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-[(4-fluorophenyl)methanesulfonyl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide
1-[(4-fluorophenyl)methanesulfonyl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-1968 |
| Compound Name: | 1-[(4-fluorophenyl)methanesulfonyl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide |
| Molecular Weight: | 468.55 |
| Molecular Formula: | C25 H25 F N2 O4 S |
| Smiles: | C1CN(CCC1C(Nc1ccc(cc1)Oc1ccccc1)=O)S(Cc1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0648 |
| logD: | 4.0648 |
| logSw: | -4.1303 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.683 |
| InChI Key: | SOKWKTVEMJAFMP-UHFFFAOYSA-N |