N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methanesulfonyl]piperidine-4-carboxamide
					Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methanesulfonyl]piperidine-4-carboxamide
			N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methanesulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | D356-2005 | 
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methanesulfonyl]piperidine-4-carboxamide | 
| Molecular Weight: | 464.56 | 
| Molecular Formula: | C23 H29 F N2 O5 S | 
| Smiles: | COc1ccc(CCNC(C2CCN(CC2)S(Cc2ccc(cc2)F)(=O)=O)=O)cc1OC | 
| Stereo: | ACHIRAL | 
| logP: | 1.7542 | 
| logD: | 1.7542 | 
| logSw: | -2.5251 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 71.359 | 
| InChI Key: | QUSAGXILQXLUFN-UHFFFAOYSA-N | 
 
				 
				