N-(2-{[(furan-2-yl)methyl]carbamoyl}phenyl)-1-(thiophene-2-sulfonyl)piperidine-3-carboxamide
Chemical Structure Depiction of
N-(2-{[(furan-2-yl)methyl]carbamoyl}phenyl)-1-(thiophene-2-sulfonyl)piperidine-3-carboxamide
N-(2-{[(furan-2-yl)methyl]carbamoyl}phenyl)-1-(thiophene-2-sulfonyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | D356-2451 |
| Compound Name: | N-(2-{[(furan-2-yl)methyl]carbamoyl}phenyl)-1-(thiophene-2-sulfonyl)piperidine-3-carboxamide |
| Molecular Weight: | 473.57 |
| Molecular Formula: | C22 H23 N3 O5 S2 |
| Smiles: | C1CC(CN(C1)S(c1cccs1)(=O)=O)C(Nc1ccccc1C(NCc1ccco1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8431 |
| logD: | 2.8381 |
| logSw: | -3.7046 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.457 |
| InChI Key: | JUBZDMQQIPSSED-INIZCTEOSA-N |