2-{[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl}-6-phenylpyridine-3-carbonitrile
Chemical Structure Depiction of
2-{[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl}-6-phenylpyridine-3-carbonitrile
2-{[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl}-6-phenylpyridine-3-carbonitrile
Compound characteristics
| Compound ID: | D360-0759 |
| Compound Name: | 2-{[2-(4-nitrophenyl)-2-oxoethyl]sulfanyl}-6-phenylpyridine-3-carbonitrile |
| Molecular Weight: | 375.4 |
| Molecular Formula: | C20 H13 N3 O3 S |
| Smiles: | C(C(c1ccc(cc1)[N+]([O-])=O)=O)Sc1c(C#N)ccc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.6571 |
| logD: | 4.6571 |
| logSw: | -4.8916 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.127 |
| InChI Key: | MUGWQKBCUKLVIT-UHFFFAOYSA-N |