7-(4-chlorophenyl)-2-(3-methylanilino)-7,8-dihydroquinazolin-5(6H)-one
Chemical Structure Depiction of
7-(4-chlorophenyl)-2-(3-methylanilino)-7,8-dihydroquinazolin-5(6H)-one
7-(4-chlorophenyl)-2-(3-methylanilino)-7,8-dihydroquinazolin-5(6H)-one
Compound characteristics
| Compound ID: | D367-0426 |
| Compound Name: | 7-(4-chlorophenyl)-2-(3-methylanilino)-7,8-dihydroquinazolin-5(6H)-one |
| Molecular Weight: | 363.85 |
| Molecular Formula: | C21 H18 Cl N3 O |
| Smiles: | Cc1cccc(c1)Nc1ncc2C(CC(Cc2n1)c1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2752 |
| logD: | 5.2752 |
| logSw: | -5.826 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.776 |
| InChI Key: | XFSQDMRPLKLGOU-HNNXBMFYSA-N |