4-methyl-7-(2-methylphenyl)-2-{[2-(morpholin-4-yl)ethyl]amino}-7,8-dihydroquinazolin-5(6H)-one
Chemical Structure Depiction of
4-methyl-7-(2-methylphenyl)-2-{[2-(morpholin-4-yl)ethyl]amino}-7,8-dihydroquinazolin-5(6H)-one
4-methyl-7-(2-methylphenyl)-2-{[2-(morpholin-4-yl)ethyl]amino}-7,8-dihydroquinazolin-5(6H)-one
Compound characteristics
| Compound ID: | D367-0443 |
| Compound Name: | 4-methyl-7-(2-methylphenyl)-2-{[2-(morpholin-4-yl)ethyl]amino}-7,8-dihydroquinazolin-5(6H)-one |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C22 H28 N4 O2 |
| Smiles: | Cc1ccccc1C1CC(c2c(C)nc(NCCN3CCOCC3)nc2C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0491 |
| logD: | 2.9602 |
| logSw: | -3.0743 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.886 |
| InChI Key: | KBAODRCBGKUVTE-QGZVFWFLSA-N |