N-[4-(3,4-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[4-(3,4-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-fluorobenzamide
N-[4-(3,4-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | D370-0146 |
| Compound Name: | N-[4-(3,4-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2-fluorobenzamide |
| Molecular Weight: | 311.31 |
| Molecular Formula: | C17 H14 F N3 O2 |
| Smiles: | [H]N(C(c1ccccc1F)=O)c1c(c2ccc(C)c(C)c2)non1 |
| Stereo: | ACHIRAL |
| logP: | 4.6414 |
| logD: | 4.4939 |
| logSw: | -4.4185 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.086 |
| InChI Key: | PFUBXZFZQOCQMW-UHFFFAOYSA-N |