N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide
Chemical Structure Depiction of
N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide
N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide
Compound characteristics
| Compound ID: | D380-0316 |
| Compound Name: | N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide |
| Molecular Weight: | 370.45 |
| Molecular Formula: | C24 H22 N2 O2 |
| Smiles: | [H]N(CC(c1ccc(cc1)OC)c1c[nH]c2ccccc12)C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4974 |
| logD: | 4.4974 |
| logSw: | -4.285 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.795 |
| InChI Key: | REVXWUIMWFLUGN-OAQYLSRUSA-N |