2-(4-fluorophenoxy)-N-[2-(piperidin-1-yl)-2-(thiophen-2-yl)ethyl]acetamide
Chemical Structure Depiction of
2-(4-fluorophenoxy)-N-[2-(piperidin-1-yl)-2-(thiophen-2-yl)ethyl]acetamide
2-(4-fluorophenoxy)-N-[2-(piperidin-1-yl)-2-(thiophen-2-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | D388-0561 |
| Compound Name: | 2-(4-fluorophenoxy)-N-[2-(piperidin-1-yl)-2-(thiophen-2-yl)ethyl]acetamide |
| Molecular Weight: | 362.46 |
| Molecular Formula: | C19 H23 F N2 O2 S |
| Smiles: | [H]N(CC(c1cccs1)N1CCCCC1)C(COc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8723 |
| logD: | 2.3044 |
| logSw: | -3.2174 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.945 |
| InChI Key: | TUMRGTAPDWZFPI-KRWDZBQOSA-N |