3-(4-chlorophenyl)-5-methyl-N-[(oxolan-2-yl)methyl]-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
3-(4-chlorophenyl)-5-methyl-N-[(oxolan-2-yl)methyl]-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
3-(4-chlorophenyl)-5-methyl-N-[(oxolan-2-yl)methyl]-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D393-0310 |
| Compound Name: | 3-(4-chlorophenyl)-5-methyl-N-[(oxolan-2-yl)methyl]-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 410.82 |
| Molecular Formula: | C19 H18 Cl F3 N4 O |
| Smiles: | Cc1cc(NCC2CCCO2)n2c(c(c3ccc(cc3)[Cl])c(C(F)(F)F)n2)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2017 |
| logD: | 4.1695 |
| logSw: | -4.8132 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.75 |
| InChI Key: | PZAAIIGBISJMNK-CQSZACIVSA-N |