3-(4-chlorophenyl)-5-methyl-N-propyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
3-(4-chlorophenyl)-5-methyl-N-propyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
3-(4-chlorophenyl)-5-methyl-N-propyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | D393-0323 |
| Compound Name: | 3-(4-chlorophenyl)-5-methyl-N-propyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 368.79 |
| Molecular Formula: | C17 H16 Cl F3 N4 |
| Smiles: | CCCNc1cc(C)nc2c(c3ccc(cc3)[Cl])c(C(F)(F)F)nn12 |
| Stereo: | ACHIRAL |
| logP: | 4.8994 |
| logD: | 4.8672 |
| logSw: | -5.1891 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.2087 |
| InChI Key: | XKBQTBMOWKQOEC-UHFFFAOYSA-N |