(4-bromo-1-methyl-1H-pyrazol-5-yl)[2-(thiophen-2-yl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
(4-bromo-1-methyl-1H-pyrazol-5-yl)[2-(thiophen-2-yl)pyrrolidin-1-yl]methanone
(4-bromo-1-methyl-1H-pyrazol-5-yl)[2-(thiophen-2-yl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | D398-0046 |
| Compound Name: | (4-bromo-1-methyl-1H-pyrazol-5-yl)[2-(thiophen-2-yl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 340.24 |
| Molecular Formula: | C13 H14 Br N3 O S |
| Smiles: | Cn1c(C(N2CCCC2c2cccs2)=O)c(cn1)[Br] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9676 |
| logD: | 1.9676 |
| logSw: | -2.0525 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.2093 |
| InChI Key: | VXRSYUSWTBSHFZ-JTQLQIEISA-N |