1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethan-1-one
Chemical Structure Depiction of
1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethan-1-one
1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethan-1-one
Compound characteristics
| Compound ID: | D398-0184 |
| Compound Name: | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethan-1-one |
| Molecular Weight: | 343.85 |
| Molecular Formula: | C20 H22 Cl N O2 |
| Smiles: | CCOc1ccc(CC(N2CCCC2c2ccc(cc2)[Cl])=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3451 |
| logD: | 4.3451 |
| logSw: | -4.6953 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.2713 |
| InChI Key: | LRRQEBABHHHDHD-IBGZPJMESA-N |