2-(3-methoxyphenyl)-1-[2-(4-methylphenyl)pyrrolidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(3-methoxyphenyl)-1-[2-(4-methylphenyl)pyrrolidin-1-yl]ethan-1-one
2-(3-methoxyphenyl)-1-[2-(4-methylphenyl)pyrrolidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | D398-0271 |
| Compound Name: | 2-(3-methoxyphenyl)-1-[2-(4-methylphenyl)pyrrolidin-1-yl]ethan-1-one |
| Molecular Weight: | 309.41 |
| Molecular Formula: | C20 H23 N O2 |
| Smiles: | Cc1ccc(cc1)C1CCCN1C(Cc1cccc(c1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9057 |
| logD: | 3.9057 |
| logSw: | -3.931 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.6915 |
| InChI Key: | TYSSJDYCGKQYRC-IBGZPJMESA-N |