(4-chloro-1-methyl-1H-pyrazol-5-yl)[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
(4-chloro-1-methyl-1H-pyrazol-5-yl)[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone
(4-chloro-1-methyl-1H-pyrazol-5-yl)[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | D398-0523 |
| Compound Name: | (4-chloro-1-methyl-1H-pyrazol-5-yl)[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 319.79 |
| Molecular Formula: | C16 H18 Cl N3 O2 |
| Smiles: | Cn1c(C(N2CCCC2c2ccc(cc2)OC)=O)c(cn1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2495 |
| logD: | 2.2495 |
| logSw: | -2.966 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.735 |
| InChI Key: | DBGSCUZSGYMNOY-AWEZNQCLSA-N |