2-(3-methoxyphenyl)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(3-methoxyphenyl)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]ethan-1-one
2-(3-methoxyphenyl)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | D398-0558 |
| Compound Name: | 2-(3-methoxyphenyl)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]ethan-1-one |
| Molecular Weight: | 325.41 |
| Molecular Formula: | C20 H23 N O3 |
| Smiles: | COc1ccc(cc1)C1CCCN1C(Cc1cccc(c1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4647 |
| logD: | 3.4647 |
| logSw: | -3.6218 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.2353 |
| InChI Key: | PWAKTSGLUBDNKQ-IBGZPJMESA-N |