[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl][2-(1-ethyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl][2-(1-ethyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone
[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl][2-(1-ethyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | D398-0707 |
| Compound Name: | [3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl][2-(1-ethyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 402.85 |
| Molecular Formula: | C20 H20 Cl F N4 O2 |
| Smiles: | CCn1c(ccn1)C1CCCN1C(c1c(c2c(cccc2[Cl])F)noc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6062 |
| logD: | 2.6062 |
| logSw: | -3.4542 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 51.724 |
| InChI Key: | JYJHTFPRUFBMOP-HNNXBMFYSA-N |