[2-(3-fluorophenyl)pyrrolidin-1-yl][5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone
Chemical Structure Depiction of
[2-(3-fluorophenyl)pyrrolidin-1-yl][5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone
[2-(3-fluorophenyl)pyrrolidin-1-yl][5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone
Compound characteristics
| Compound ID: | D398-0975 |
| Compound Name: | [2-(3-fluorophenyl)pyrrolidin-1-yl][5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone |
| Molecular Weight: | 366.39 |
| Molecular Formula: | C21 H19 F N2 O3 |
| Smiles: | COc1ccc(cc1)c1cc(C(N2CCCC2c2cccc(c2)F)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1325 |
| logD: | 4.1325 |
| logSw: | -4.2549 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.754 |
| InChI Key: | SENIWJAQBUVNTQ-IBGZPJMESA-N |