(5-cyclopropyl-1,2-oxazol-3-yl)[2-(4-fluorophenyl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
(5-cyclopropyl-1,2-oxazol-3-yl)[2-(4-fluorophenyl)pyrrolidin-1-yl]methanone
(5-cyclopropyl-1,2-oxazol-3-yl)[2-(4-fluorophenyl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | D398-1080 |
| Compound Name: | (5-cyclopropyl-1,2-oxazol-3-yl)[2-(4-fluorophenyl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 300.33 |
| Molecular Formula: | C17 H17 F N2 O2 |
| Smiles: | C1CC(c2ccc(cc2)F)N(C1)C(c1cc(C2CC2)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3033 |
| logD: | 3.3033 |
| logSw: | -3.3795 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.734 |
| InChI Key: | VRAYFCVMAINIGP-HNNXBMFYSA-N |